C11H13NO — CID 45091198
2-(4-methoxy-3,5-dimethylphenyl)acetonitrile (PubChem CID 45091198) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-(4-methoxy-3,5-dimethylphenyl)acetonitrile.
| Compound Name | 2-(4-methoxy-3,5-dimethylphenyl)acetonitrile |
|---|---|
| PubChem CID | 45091198 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2-(4-methoxy-3,5-dimethylphenyl)acetonitrile |
| SMILES | COc1c(C)cc(CC#N)cc1C |
| InChI | InChI=1S/C11H13NO/c1-8-6-10(4-5-12)7-9(2)11(8)13-3/h6-7H,4H2,1-3H3 |
| InChIKey | PXCJWMOHBMPEPY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |