C11H10N2O2 — CID 117290768
5-(cyanomethyl)-2,3-dimethoxybenzonitrile (PubChem CID 117290768) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 5-(cyanomethyl)-2,3-dimethoxybenzonitrile.
| Compound Name | 5-(cyanomethyl)-2,3-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 117290768 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 5-(cyanomethyl)-2,3-dimethoxybenzonitrile |
| SMILES | COc1cc(CC#N)cc(C#N)c1OC |
| InChI | InChI=1S/C11H10N2O2/c1-14-10-6-8(3-4-12)5-9(7-13)11(10)15-2/h5-6H,3H2,1-2H3 |
| InChIKey | YMGLQVQKLIOGRZ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |