C13H17NO2 — CID 19838260
2-(3,4-dimethoxy-5-propylphenyl)acetonitrile (PubChem CID 19838260) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-5-propylphenyl)acetonitrile.
| Compound Name | 2-(3,4-dimethoxy-5-propylphenyl)acetonitrile |
|---|---|
| PubChem CID | 19838260 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(3,4-dimethoxy-5-propylphenyl)acetonitrile |
| SMILES | CCCc1cc(CC#N)cc(OC)c1OC |
| InChI | InChI=1S/C13H17NO2/c1-4-5-11-8-10(6-7-14)9-12(15-2)13(11)16-3/h8-9H,4-6H2,1-3H3 |
| InChIKey | XOCLCRNBWSQIPT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |