C14H19NO2S — CID 44719636
2-(4-butylsulfanyl-3,5-dimethoxyphenyl)acetonitrile (PubChem CID 44719636) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-(4-butylsulfanyl-3,5-dimethoxyphenyl)acetonitrile.
| Compound Name | 2-(4-butylsulfanyl-3,5-dimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 44719636 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-(4-butylsulfanyl-3,5-dimethoxyphenyl)acetonitrile |
| SMILES | CCCCSc1c(OC)cc(CC#N)cc1OC |
| InChI | InChI=1S/C14H19NO2S/c1-4-5-8-18-14-12(16-2)9-11(6-7-15)10-13(14)17-3/h9-10H,4-6,8H2,1-3H3 |
| InChIKey | USQSBZWYAYZNPL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|