C11H10N2O2 — CID 177120940
2-(4-isocyano-3,5-dimethoxyphenyl)acetonitrile (PubChem CID 177120940) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-(4-isocyano-3,5-dimethoxyphenyl)acetonitrile.
| Compound Name | 2-(4-isocyano-3,5-dimethoxyphenyl)acetonitrile |
|---|---|
| PubChem CID | 177120940 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 2-(4-isocyano-3,5-dimethoxyphenyl)acetonitrile |
| SMILES | [C-]#[N+]c1c(OC)cc(CC#N)cc1OC |
| InChI | InChI=1S/C11H10N2O2/c1-13-11-9(14-2)6-8(4-5-12)7-10(11)15-3/h6-7H,4H2,2-3H3 |
| InChIKey | NZXHUOMAADIBDX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|