C12H15NO3 — CID 177120895
5-(ethoxymethyl)-2-isocyano-1,3-dimethoxybenzene (PubChem CID 177120895) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 5-(ethoxymethyl)-2-isocyano-1,3-dimethoxybenzene.
| Compound Name | 5-(ethoxymethyl)-2-isocyano-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 177120895 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 5-(ethoxymethyl)-2-isocyano-1,3-dimethoxybenzene |
| SMILES | [C-]#[N+]c1c(OC)cc(COCC)cc1OC |
| InChI | InChI=1S/C12H15NO3/c1-5-16-8-9-6-10(14-3)12(13-2)11(7-9)15-4/h6-7H,5,8H2,1,3-4H3 |
| InChIKey | XNIAIRRZAPYHCU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|