C11H16O3 — CID 12068886
2-(ethoxymethyl)-1,4-dimethoxybenzene (PubChem CID 12068886) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-(ethoxymethyl)-1,4-dimethoxybenzene.
| Compound Name | 2-(ethoxymethyl)-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 12068886 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2-(ethoxymethyl)-1,4-dimethoxybenzene |
| SMILES | CCOCc1cc(OC)ccc1OC |
| InChI | InChI=1S/C11H16O3/c1-4-14-8-9-7-10(12-2)5-6-11(9)13-3/h5-7H,4,8H2,1-3H3 |
| InChIKey | YJZBANMQBHLFON-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |