C24H34O8 — CID 15109386
2-[2-[2-[2-[(2,5-dimethoxyphenyl)methoxy]ethoxy]ethoxy]ethoxymethyl]-1,4-dimethoxybenzene (PubChem CID 15109386) has the molecular formula C24H34O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is 2-[2-[2-[2-[(2,5-dimethoxyphenyl)methoxy]ethoxy]ethoxy]ethoxymethyl]-1,4-dimethoxybenzene.
| Compound Name | 2-[2-[2-[2-[(2,5-dimethoxyphenyl)methoxy]ethoxy]ethoxy]ethoxymethyl]-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 15109386 |
| Molecular Formula | C24H34O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 2-[2-[2-[2-[(2,5-dimethoxyphenyl)methoxy]ethoxy]ethoxy]ethoxymethyl]-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(COCCOCCOCCOCc2cc(OC)ccc2OC)c1 |
| InChI | InChI=1S/C24H34O8/c1-25-21-5-7-23(27-3)19(15-21)17-31-13-11-29-9-10-30-12-14-32-18-20-16-22(26-2)6-8-24(20)28-4/h5-8,15-16H,9-14,17-18H2,1-4H3 |
| InChIKey | WTTMWYQPYNQOKN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|