C18H29NO4 — CID 42588345
(2S)-1-(azepan-1-yl)-3-[(2,5-dimethoxyphenyl)methoxy]propan-2-ol (PubChem CID 42588345) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is (2S)-1-(azepan-1-yl)-3-[(2,5-dimethoxyphenyl)methoxy]propan-2-ol.
| Compound Name | (2S)-1-(azepan-1-yl)-3-[(2,5-dimethoxyphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 42588345 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | (2S)-1-(azepan-1-yl)-3-[(2,5-dimethoxyphenyl)methoxy]propan-2-ol |
| SMILES | COc1ccc(OC)c(COC[C@@H](O)CN2CCCCCC2)c1 |
| InChI | InChI=1S/C18H29NO4/c1-21-17-7-8-18(22-2)15(11-17)13-23-14-16(20)12-19-9-5-3-4-6-10-19/h7-8,11,16,20H,3-6,9-10,12-14H2,1-2H3/t16-/m0/s1 |
| InChIKey | PSRCCGUNGRKLBO-INIZCTEOSA-N |
| XLogP | 2.46 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |