C12H20O5S — CID 90981417
(2,5-dimethoxyphenyl)methyl methanesulfonate;ethane (PubChem CID 90981417) has the molecular formula C12H20O5S and a molecular weight of 276.35 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyl methanesulfonate;ethane.
| Compound Name | (2,5-dimethoxyphenyl)methyl methanesulfonate;ethane |
|---|---|
| PubChem CID | 90981417 |
| Molecular Formula | C12H20O5S |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyl methanesulfonate;ethane |
| SMILES | CC.COc1ccc(OC)c(COS(C)(=O)=O)c1 |
| InChI | InChI=1S/C10H14O5S.C2H6/c1-13-9-4-5-10(14-2)8(6-9)7-15-16(3,11)12;1-2/h4-6H,7H2,1-3H3;1-2H3 |
| InChIKey | BJISJKXCGYWIIP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|