C9H11NO3 — CID 143996904
1,4-dimethoxy-2-(nitrosomethyl)benzene (PubChem CID 143996904) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1,4-dimethoxy-2-(nitrosomethyl)benzene.
| Compound Name | 1,4-dimethoxy-2-(nitrosomethyl)benzene |
|---|---|
| PubChem CID | 143996904 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 1,4-dimethoxy-2-(nitrosomethyl)benzene |
| SMILES | COc1ccc(OC)c(CN=O)c1 |
| InChI | InChI=1S/C9H11NO3/c1-12-8-3-4-9(13-2)7(5-8)6-10-11/h3-5H,6H2,1-2H3 |
| InChIKey | MDZFSNUHQLASLN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |