C9H12N2O2 — CID 123249085
(2,5-dimethoxyphenyl)methyldiazene (PubChem CID 123249085) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (2,5-dimethoxyphenyl)methyldiazene.
| Compound Name | (2,5-dimethoxyphenyl)methyldiazene |
|---|---|
| PubChem CID | 123249085 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (2,5-dimethoxyphenyl)methyldiazene |
| SMILES | [H]/N=N/Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C9H12N2O2/c1-12-8-3-4-9(13-2)7(5-8)6-11-10/h3-5,10H,6H2,1-2H3/b11-10+ |
| InChIKey | KTCKONKZNKZZJM-ZHACJKMWSA-N |
| XLogP | 2.23 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|