C12H16O3 — CID 135008625
(E)-4-(2,5-dimethoxyphenyl)but-2-en-1-ol (PubChem CID 135008625) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (E)-4-(2,5-dimethoxyphenyl)but-2-en-1-ol.
| Compound Name | (E)-4-(2,5-dimethoxyphenyl)but-2-en-1-ol |
|---|---|
| PubChem CID | 135008625 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (E)-4-(2,5-dimethoxyphenyl)but-2-en-1-ol |
| SMILES | COc1ccc(OC)c(C/C=C/CO)c1 |
| InChI | InChI=1S/C12H16O3/c1-14-11-6-7-12(15-2)10(9-11)5-3-4-8-13/h3-4,6-7,9,13H,5,8H2,1-2H3/b4-3+ |
| InChIKey | YKPJAJNCGXSHNN-ONEGZZNKSA-N |
| XLogP | 1.79 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|