C22H26N2O3 — CID 177461961
(E)-4-[5-methoxy-2-[(E)-N-[(E)-1-(4-methoxyphenyl)ethylideneamino]-C-methylcarbonimidoyl]phenyl]but-2-en-1-ol (PubChem CID 177461961) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (E)-4-[5-methoxy-2-[(E)-N-[(E)-1-(4-methoxyphenyl)ethylideneamino]-C-methylcarbonimidoyl]phenyl]but-2-en-1-ol.
| Compound Name | (E)-4-[5-methoxy-2-[(E)-N-[(E)-1-(4-methoxyphenyl)ethylideneamino]-C-methylcarbonimidoyl]phenyl]but-2-en-1-ol |
|---|---|
| PubChem CID | 177461961 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (E)-4-[5-methoxy-2-[(E)-N-[(E)-1-(4-methoxyphenyl)ethylideneamino]-C-methylcarbonimidoyl]phenyl]but-2-en-1-ol |
| SMILES | COc1ccc(/C(C)=N/N=C(\C)c2ccc(OC)cc2C/C=C/CO)cc1 |
| InChI | InChI=1S/C22H26N2O3/c1-16(18-8-10-20(26-3)11-9-18)23-24-17(2)22-13-12-21(27-4)15-19(22)7-5-6-14-25/h5-6,8-13,15,25H,7,14H2,1-4H3/b6-5+,23-16+,24-17+ |
| InChIKey | UOZIZVLOTZDKEP-DHPSNZHNSA-N |
| XLogP | 4.03 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|