C13H20O3 — CID 116930738
2-[(2,5-dimethoxyphenyl)methyl]butan-1-ol (PubChem CID 116930738) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)methyl]butan-1-ol.
| Compound Name | 2-[(2,5-dimethoxyphenyl)methyl]butan-1-ol |
|---|---|
| PubChem CID | 116930738 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)methyl]butan-1-ol |
| SMILES | CCC(CO)Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H20O3/c1-4-10(9-14)7-11-8-12(15-2)5-6-13(11)16-3/h5-6,8,10,14H,4,7,9H2,1-3H3 |
| InChIKey | WLUAERRZWQCKIT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |