C12H15NO3 — CID 82350267
2-[(2,5-dimethoxyphenyl)methyl]-3-hydroxypropanenitrile (PubChem CID 82350267) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)methyl]-3-hydroxypropanenitrile.
| Compound Name | 2-[(2,5-dimethoxyphenyl)methyl]-3-hydroxypropanenitrile |
|---|---|
| PubChem CID | 82350267 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)methyl]-3-hydroxypropanenitrile |
| SMILES | COc1ccc(OC)c(CC(C#N)CO)c1 |
| InChI | InChI=1S/C12H15NO3/c1-15-11-3-4-12(16-2)10(6-11)5-9(7-13)8-14/h3-4,6,9,14H,5,8H2,1-2H3 |
| InChIKey | XZHMAQDBKKZPHD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |