C12H18O2S — CID 83938199
3-(2,5-dimethoxyphenyl)-2-methylpropane-1-thiol (PubChem CID 83938199) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-2-methylpropane-1-thiol.
| Compound Name | 3-(2,5-dimethoxyphenyl)-2-methylpropane-1-thiol |
|---|---|
| PubChem CID | 83938199 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-2-methylpropane-1-thiol |
| SMILES | COc1ccc(OC)c(CC(C)CS)c1 |
| InChI | InChI=1S/C12H18O2S/c1-9(8-15)6-10-7-11(13-2)4-5-12(10)14-3/h4-5,7,9,15H,6,8H2,1-3H3 |
| InChIKey | CQKOIPIBICJAFX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|