C11H15ClOS — CID 83928473
3-(3-chloro-4-methoxyphenyl)-2-methylpropane-1-thiol (PubChem CID 83928473) has the molecular formula C11H15ClOS and a molecular weight of 230.76 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-2-methylpropane-1-thiol.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-2-methylpropane-1-thiol |
|---|---|
| PubChem CID | 83928473 |
| Molecular Formula | C11H15ClOS |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-2-methylpropane-1-thiol |
| SMILES | COc1ccc(CC(C)CS)cc1Cl |
| InChI | InChI=1S/C11H15ClOS/c1-8(7-14)5-9-3-4-11(13-2)10(12)6-9/h3-4,6,8,14H,5,7H2,1-2H3 |
| InChIKey | YTMSWWFDDMJBHE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|