C12H17ClO2 — CID 64666940
4-(3-chloro-2-methylpropyl)-1,2-dimethoxybenzene (PubChem CID 64666940) has the molecular formula C12H17ClO2 and a molecular weight of 228.72 g/mol. Its IUPAC name is 4-(3-chloro-2-methylpropyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(3-chloro-2-methylpropyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 64666940 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 4-(3-chloro-2-methylpropyl)-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CC(C)CCl)cc1OC |
| InChI | InChI=1S/C12H17ClO2/c1-9(8-13)6-10-4-5-11(14-2)12(7-10)15-3/h4-5,7,9H,6,8H2,1-3H3 |
| InChIKey | NUTVINGBRFZGQF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|