C14H21ClO2 — CID 79307803
4-(3-chloro-2-methylpentyl)-1,2-dimethoxybenzene (PubChem CID 79307803) has the molecular formula C14H21ClO2 and a molecular weight of 256.77 g/mol. Its IUPAC name is 4-(3-chloro-2-methylpentyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(3-chloro-2-methylpentyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 79307803 |
| Molecular Formula | C14H21ClO2 |
| Molecular Weight | 256.77 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 4-(3-chloro-2-methylpentyl)-1,2-dimethoxybenzene |
| SMILES | CCC(Cl)C(C)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H21ClO2/c1-5-12(15)10(2)8-11-6-7-13(16-3)14(9-11)17-4/h6-7,9-10,12H,5,8H2,1-4H3 |
| InChIKey | SGFOTEUMODUTHT-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.77 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|