C12H15ClO3 — CID 82185003
3-chloro-4-(3,4-dimethoxyphenyl)butan-2-one (PubChem CID 82185003) has the molecular formula C12H15ClO3 and a molecular weight of 242.70 g/mol. Its IUPAC name is 3-chloro-4-(3,4-dimethoxyphenyl)butan-2-one.
| Compound Name | 3-chloro-4-(3,4-dimethoxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 82185003 |
| Molecular Formula | C12H15ClO3 |
| Molecular Weight | 242.70 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-chloro-4-(3,4-dimethoxyphenyl)butan-2-one |
| SMILES | COc1ccc(CC(Cl)C(C)=O)cc1OC |
| InChI | InChI=1S/C12H15ClO3/c1-8(14)10(13)6-9-4-5-11(15-2)12(7-9)16-3/h4-5,7,10H,6H2,1-3H3 |
| InChIKey | UJYIKEAAVMOTGT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.70 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|