C14H19ClO4 — CID 82352130
ethyl 3-chloro-4-(3,4-dimethoxyphenyl)butanoate (PubChem CID 82352130) has the molecular formula C14H19ClO4 and a molecular weight of 286.75 g/mol. Its IUPAC name is ethyl 3-chloro-4-(3,4-dimethoxyphenyl)butanoate.
| Compound Name | ethyl 3-chloro-4-(3,4-dimethoxyphenyl)butanoate |
|---|---|
| PubChem CID | 82352130 |
| Molecular Formula | C14H19ClO4 |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | ethyl 3-chloro-4-(3,4-dimethoxyphenyl)butanoate |
| SMILES | CCOC(=O)CC(Cl)Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H19ClO4/c1-4-19-14(16)9-11(15)7-10-5-6-12(17-2)13(8-10)18-3/h5-6,8,11H,4,7,9H2,1-3H3 |
| InChIKey | RNBIOBUOLCLGGY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|