C21H26O5 — CID 139755325
ethyl 4-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)butanoate (PubChem CID 139755325) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is ethyl 4-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)butanoate.
| Compound Name | ethyl 4-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)butanoate |
|---|---|
| PubChem CID | 139755325 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | ethyl 4-(3,4-dimethoxyphenyl)-3-(4-methoxyphenyl)butanoate |
| SMILES | CCOC(=O)CC(Cc1ccc(OC)c(OC)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H26O5/c1-5-26-21(22)14-17(16-7-9-18(23-2)10-8-16)12-15-6-11-19(24-3)20(13-15)25-4/h6-11,13,17H,5,12,14H2,1-4H3 |
| InChIKey | NMJZNJBDAAWTJA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |