C19H22O5 — CID 10449310
1-(3,4-dimethoxyphenyl)-4-hydroxy-4-(4-methoxyphenyl)butan-2-one (PubChem CID 10449310) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-4-hydroxy-4-(4-methoxyphenyl)butan-2-one.
| Compound Name | 1-(3,4-dimethoxyphenyl)-4-hydroxy-4-(4-methoxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 10449310 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-4-hydroxy-4-(4-methoxyphenyl)butan-2-one |
| SMILES | COc1ccc(C(O)CC(=O)Cc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H22O5/c1-22-16-7-5-14(6-8-16)17(21)12-15(20)10-13-4-9-18(23-2)19(11-13)24-3/h4-9,11,17,21H,10,12H2,1-3H3 |
| InChIKey | ZFNUTJSHPLOZQP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |