C17H20O4 — CID 78933373
(1S)-1-[4-[(3,4-dimethoxyphenyl)methoxy]phenyl]ethanol (PubChem CID 78933373) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (1S)-1-[4-[(3,4-dimethoxyphenyl)methoxy]phenyl]ethanol.
| Compound Name | (1S)-1-[4-[(3,4-dimethoxyphenyl)methoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 78933373 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (1S)-1-[4-[(3,4-dimethoxyphenyl)methoxy]phenyl]ethanol |
| SMILES | COc1ccc(COc2ccc([C@H](C)O)cc2)cc1OC |
| InChI | InChI=1S/C17H20O4/c1-12(18)14-5-7-15(8-6-14)21-11-13-4-9-16(19-2)17(10-13)20-3/h4-10,12,18H,11H2,1-3H3/t12-/m0/s1 |
| InChIKey | OCOXDZYYYPOJNC-LBPRGKRZSA-N |
| XLogP | 3.34 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |