C27H34ClNO4 — CID 110185116
3-(3,4-dimethoxyphenyl)propyl-[1-hydroxy-1-(4-phenylmethoxyphenyl)propan-2-yl]azanium chloride (PubChem CID 110185116) has the molecular formula C27H34ClNO4 and a molecular weight of 472.03 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)propyl-[1-hydroxy-1-(4-phenylmethoxyphenyl)propan-2-yl]azanium chloride.
| Compound Name | 3-(3,4-dimethoxyphenyl)propyl-[1-hydroxy-1-(4-phenylmethoxyphenyl)propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 110185116 |
| Molecular Formula | C27H34ClNO4 |
| Molecular Weight | 472.03 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)propyl-[1-hydroxy-1-(4-phenylmethoxyphenyl)propan-2-yl]azanium chloride |
| SMILES | COc1ccc(CCC[NH2+]C(C)C(O)c2ccc(OCc3ccccc3)cc2)cc1OC.[Cl-] |
| InChI | InChI=1S/C27H33NO4.ClH/c1-20(28-17-7-10-21-11-16-25(30-2)26(18-21)31-3)27(29)23-12-14-24(15-13-23)32-19-22-8-5-4-6-9-22;/h4-6,8-9,11-16,18,20,27-29H,7,10,17,19H2,1-3H3;1H |
| InChIKey | DPYWLVKOWNVKEB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 64.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.03 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|