C19H26ClNO3 — CID 110185130
[1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-[3-(3-methoxyphenyl)propyl]azanium chloride (PubChem CID 110185130) has the molecular formula C19H26ClNO3 and a molecular weight of 351.87 g/mol. Its IUPAC name is [1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-[3-(3-methoxyphenyl)propyl]azanium chloride.
| Compound Name | [1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-[3-(3-methoxyphenyl)propyl]azanium chloride |
|---|---|
| PubChem CID | 110185130 |
| Molecular Formula | C19H26ClNO3 |
| Molecular Weight | 351.87 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]-[3-(3-methoxyphenyl)propyl]azanium chloride |
| SMILES | COc1cccc(CCC[NH2+]C(C)C(O)c2ccc(O)cc2)c1.[Cl-] |
| InChI | InChI=1S/C19H25NO3.ClH/c1-14(19(22)16-8-10-17(21)11-9-16)20-12-4-6-15-5-3-7-18(13-15)23-2;/h3,5,7-11,13-14,19-22H,4,6,12H2,1-2H3;1H |
| InChIKey | FQDLDJMEUUCIFL-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.87 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|