C20H28ClNO2 — CID 110184914
3-(3-methoxyphenyl)propyl-[3-(4-methoxyphenyl)propyl]azanium chloride (PubChem CID 110184914) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)propyl-[3-(4-methoxyphenyl)propyl]azanium chloride.
| Compound Name | 3-(3-methoxyphenyl)propyl-[3-(4-methoxyphenyl)propyl]azanium chloride |
|---|---|
| PubChem CID | 110184914 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 3-(3-methoxyphenyl)propyl-[3-(4-methoxyphenyl)propyl]azanium chloride |
| SMILES | COc1ccc(CCC[NH2+]CCCc2cccc(OC)c2)cc1.[Cl-] |
| InChI | InChI=1S/C20H27NO2.ClH/c1-22-19-12-10-17(11-13-19)7-4-14-21-15-5-8-18-6-3-9-20(16-18)23-2;/h3,6,9-13,16,21H,4-5,7-8,14-15H2,1-2H3;1H |
| InChIKey | IHNYKLCIGBDUNF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|