C26H32ClNO2 — CID 110185128
[1-hydroxy-1-(4-phenylmethoxyphenyl)propan-2-yl]-[3-(4-methylphenyl)propyl]azanium chloride (PubChem CID 110185128) has the molecular formula C26H32ClNO2 and a molecular weight of 426.00 g/mol. Its IUPAC name is [1-hydroxy-1-(4-phenylmethoxyphenyl)propan-2-yl]-[3-(4-methylphenyl)propyl]azanium chloride.
| Compound Name | [1-hydroxy-1-(4-phenylmethoxyphenyl)propan-2-yl]-[3-(4-methylphenyl)propyl]azanium chloride |
|---|---|
| PubChem CID | 110185128 |
| Molecular Formula | C26H32ClNO2 |
| Molecular Weight | 426.00 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | [1-hydroxy-1-(4-phenylmethoxyphenyl)propan-2-yl]-[3-(4-methylphenyl)propyl]azanium chloride |
| SMILES | Cc1ccc(CCC[NH2+]C(C)C(O)c2ccc(OCc3ccccc3)cc2)cc1.[Cl-] |
| InChI | InChI=1S/C26H31NO2.ClH/c1-20-10-12-22(13-11-20)9-6-18-27-21(2)26(28)24-14-16-25(17-15-24)29-19-23-7-4-3-5-8-23;/h3-5,7-8,10-17,21,26-28H,6,9,18-19H2,1-2H3;1H |
| InChIKey | JKOAYFIZURCGKV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.00 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|