C17H23NO7 — CID 68616290
methyl 3-(3,4-dimethoxyphenyl)-2-[(3-ethoxy-3-oxopropanoyl)amino]propanoate (PubChem CID 68616290) has the molecular formula C17H23NO7 and a molecular weight of 353.37 g/mol. Its IUPAC name is methyl 3-(3,4-dimethoxyphenyl)-2-[(3-ethoxy-3-oxopropanoyl)amino]propanoate.
| Compound Name | methyl 3-(3,4-dimethoxyphenyl)-2-[(3-ethoxy-3-oxopropanoyl)amino]propanoate |
|---|---|
| PubChem CID | 68616290 |
| Molecular Formula | C17H23NO7 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | methyl 3-(3,4-dimethoxyphenyl)-2-[(3-ethoxy-3-oxopropanoyl)amino]propanoate |
| SMILES | CCOC(=O)CC(=O)NC(Cc1ccc(OC)c(OC)c1)C(=O)OC |
| InChI | InChI=1S/C17H23NO7/c1-5-25-16(20)10-15(19)18-12(17(21)24-4)8-11-6-7-13(22-2)14(9-11)23-3/h6-7,9,12H,5,8,10H2,1-4H3,(H,18,19) |
| InChIKey | VBSKHRKCOUWAOZ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|