C13H15Cl2NO4 — CID 69418402
methyl (2R)-2-[(2-chloroacetyl)amino]-3-(4-chloro-3-methoxyphenyl)propanoate (PubChem CID 69418402) has the molecular formula C13H15Cl2NO4 and a molecular weight of 320.17 g/mol. Its IUPAC name is methyl (2R)-2-[(2-chloroacetyl)amino]-3-(4-chloro-3-methoxyphenyl)propanoate.
| Compound Name | methyl (2R)-2-[(2-chloroacetyl)amino]-3-(4-chloro-3-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 69418402 |
| Molecular Formula | C13H15Cl2NO4 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | methyl (2R)-2-[(2-chloroacetyl)amino]-3-(4-chloro-3-methoxyphenyl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(Cl)c(OC)c1)NC(=O)CCl |
| InChI | InChI=1S/C13H15Cl2NO4/c1-19-11-6-8(3-4-9(11)15)5-10(13(18)20-2)16-12(17)7-14/h3-4,6,10H,5,7H2,1-2H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | GIVVOVIDWREMTE-SNVBAGLBSA-N |
| XLogP | 1.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|