C12H12ClF2NO3 — CID 69417562
methyl (2R)-2-[(2-chloroacetyl)amino]-3-(3,4-difluorophenyl)propanoate (PubChem CID 69417562) has the molecular formula C12H12ClF2NO3 and a molecular weight of 291.68 g/mol. Its IUPAC name is methyl (2R)-2-[(2-chloroacetyl)amino]-3-(3,4-difluorophenyl)propanoate.
| Compound Name | methyl (2R)-2-[(2-chloroacetyl)amino]-3-(3,4-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 69417562 |
| Molecular Formula | C12H12ClF2NO3 |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | methyl (2R)-2-[(2-chloroacetyl)amino]-3-(3,4-difluorophenyl)propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(F)c(F)c1)NC(=O)CCl |
| InChI | InChI=1S/C12H12ClF2NO3/c1-19-12(18)10(16-11(17)6-13)5-7-2-3-8(14)9(15)4-7/h2-4,10H,5-6H2,1H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | ANWHVMVVLQTXSO-SNVBAGLBSA-N |
| XLogP | 1.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|