C6H10ClNO4 — CID 43311461
methyl 2-[(2-chloroacetyl)amino]-3-hydroxypropanoate (PubChem CID 43311461) has the molecular formula C6H10ClNO4 and a molecular weight of 195.60 g/mol. Its IUPAC name is methyl 2-[(2-chloroacetyl)amino]-3-hydroxypropanoate.
| Compound Name | methyl 2-[(2-chloroacetyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 43311461 |
| Molecular Formula | C6H10ClNO4 |
| Molecular Weight | 195.60 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | methyl 2-[(2-chloroacetyl)amino]-3-hydroxypropanoate |
| SMILES | COC(=O)C(CO)NC(=O)CCl |
| InChI | InChI=1S/C6H10ClNO4/c1-12-6(11)4(3-9)8-5(10)2-7/h4,9H,2-3H2,1H3,(H,8,10) |
| InChIKey | SDIQFJSMWGNNKI-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.60 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|