C9H16ClNO4 — CID 174668046
tert-butyl 2-[(2-chloroacetyl)amino]-3-hydroxypropanoate (PubChem CID 174668046) has the molecular formula C9H16ClNO4 and a molecular weight of 237.68 g/mol. Its IUPAC name is tert-butyl 2-[(2-chloroacetyl)amino]-3-hydroxypropanoate.
| Compound Name | tert-butyl 2-[(2-chloroacetyl)amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 174668046 |
| Molecular Formula | C9H16ClNO4 |
| Molecular Weight | 237.68 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | tert-butyl 2-[(2-chloroacetyl)amino]-3-hydroxypropanoate |
| SMILES | CC(C)(C)OC(=O)C(CO)NC(=O)CCl |
| InChI | InChI=1S/C9H16ClNO4/c1-9(2,3)15-8(14)6(5-12)11-7(13)4-10/h6,12H,4-5H2,1-3H3,(H,11,13) |
| InChIKey | OLJQEFWMSCGOML-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.68 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|