C18H33ClN2O4 — CID 175548223
tert-butyl 2-[[2-[(2-chloroacetyl)amino]-3-methylpentanoyl]amino]-3-methylpentanoate (PubChem CID 175548223) has the molecular formula C18H33ClN2O4 and a molecular weight of 376.93 g/mol. Its IUPAC name is tert-butyl 2-[[2-[(2-chloroacetyl)amino]-3-methylpentanoyl]amino]-3-methylpentanoate.
| Compound Name | tert-butyl 2-[[2-[(2-chloroacetyl)amino]-3-methylpentanoyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 175548223 |
| Molecular Formula | C18H33ClN2O4 |
| Molecular Weight | 376.93 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | tert-butyl 2-[[2-[(2-chloroacetyl)amino]-3-methylpentanoyl]amino]-3-methylpentanoate |
| SMILES | CCC(C)C(NC(=O)CCl)C(=O)NC(C(=O)OC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C18H33ClN2O4/c1-8-11(3)14(20-13(22)10-19)16(23)21-15(12(4)9-2)17(24)25-18(5,6)7/h11-12,14-15H,8-10H2,1-7H3,(H,20,22)(H,21,23) |
| InChIKey | CCOGYQRYKUMLOC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.93 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|