C8H13ClNO3- — CID 86308194
(2R,3S)-2-[(2-chloroacetyl)amino]-3-methylpentanoate (PubChem CID 86308194) has the molecular formula C8H13ClNO3- and a molecular weight of 206.65 g/mol. Its IUPAC name is (2R,3S)-2-[(2-chloroacetyl)amino]-3-methylpentanoate.
| Compound Name | (2R,3S)-2-[(2-chloroacetyl)amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 86308194 |
| Molecular Formula | C8H13ClNO3- |
| Molecular Weight | 206.65 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | (2R,3S)-2-[(2-chloroacetyl)amino]-3-methylpentanoate |
| SMILES | CC[C@H](C)[C@@H](NC(=O)CCl)C(=O)[O-] |
| InChI | InChI=1S/C8H14ClNO3/c1-3-5(2)7(8(12)13)10-6(11)4-9/h5,7H,3-4H2,1-2H3,(H,10,11)(H,12,13)/p-1/t5-,7+/m0/s1 |
| InChIKey | HEZNGQNQHGVQLO-CAHLUQPWSA-M |
| XLogP | -0.49 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.65 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|