C8H14Cl2N2O3 — CID 88772839
2-chloro-N-[1-[1-[(2-chloroacetyl)amino]ethoxy]ethyl]acetamide (PubChem CID 88772839) has the molecular formula C8H14Cl2N2O3 and a molecular weight of 257.12 g/mol. Its IUPAC name is 2-chloro-N-[1-[1-[(2-chloroacetyl)amino]ethoxy]ethyl]acetamide.
| Compound Name | 2-chloro-N-[1-[1-[(2-chloroacetyl)amino]ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 88772839 |
| Molecular Formula | C8H14Cl2N2O3 |
| Molecular Weight | 257.12 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 2-chloro-N-[1-[1-[(2-chloroacetyl)amino]ethoxy]ethyl]acetamide |
| SMILES | CC(NC(=O)CCl)OC(C)NC(=O)CCl |
| InChI | InChI=1S/C8H14Cl2N2O3/c1-5(11-7(13)3-9)15-6(2)12-8(14)4-10/h5-6H,3-4H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | WGEILPFMUWRMAZ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.12 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|