About [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate
[(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate (PubChem CID 44889096) has the molecular formula C9H15Cl2NO3
and a molecular weight of 256.13 g/mol. Its IUPAC name is [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate.
Molecular Properties
| Compound Name | [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate |
| PubChem CID | 44889096 |
| Molecular Formula | C9H15Cl2NO3 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate |
| SMILES | CC(C)[C@@H](COC(=O)CCl)NC(=O)CCl |
| InChI | InChI=1S/C9H15Cl2NO3/c1-6(2)7(12-8(13)3-10)5-15-9(14)4-11/h6-7H,3-5H2,1-2H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | HWCXGRBZIMIVCO-SSDOTTSWSA-N |
| XLogP | 1.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate?
The IUPAC name of [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate (CID 44889096) is [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate.
What is the SMILES notation for [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate?
The canonical SMILES for [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate is CC(C)[C@@H](COC(=O)CCl)NC(=O)CCl.
What is the InChIKey of [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate?
The InChIKey is HWCXGRBZIMIVCO-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H15Cl2NO3/c1-6(2)7(12-8(13)3-10)5-15-9(14)4-11/h6-7H,3-5H2,1-2H3,(H,12,13)/t7-/m1/s1.
What are the key properties of [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate?
[(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate has a molecular weight of 256.13 g/mol, XLogP of 1.15, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-[(2-chloroacetyl)amino]-3-methylbutyl] 2-chloroacetate is sourced from PubChem (CID 44889096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).