C7H14ClNO2 — CID 79249423
2-chloro-N-(1-hydroxy-3-methylbutan-2-yl)acetamide (PubChem CID 79249423) has the molecular formula C7H14ClNO2 and a molecular weight of 179.65 g/mol. Its IUPAC name is 2-chloro-N-(1-hydroxy-3-methylbutan-2-yl)acetamide.
| Compound Name | 2-chloro-N-(1-hydroxy-3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 79249423 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-chloro-N-(1-hydroxy-3-methylbutan-2-yl)acetamide |
| SMILES | CC(C)C(CO)NC(=O)CCl |
| InChI | InChI=1S/C7H14ClNO2/c1-5(2)6(4-10)9-7(11)3-8/h5-6,10H,3-4H2,1-2H3,(H,9,11) |
| InChIKey | CSCZQRZJAAPOMS-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|