C11H24N2O2 — CID 79249728
N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-(propan-2-ylamino)propanamide (PubChem CID 79249728) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-(propan-2-ylamino)propanamide.
| Compound Name | N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-(propan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 79249728 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-(propan-2-ylamino)propanamide |
| SMILES | CC(C)NCCC(=O)N[C@H](CO)C(C)C |
| InChI | InChI=1S/C11H24N2O2/c1-8(2)10(7-14)13-11(15)5-6-12-9(3)4/h8-10,12,14H,5-7H2,1-4H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | NOFZPCQEMHQXAL-SNVBAGLBSA-N |
| XLogP | 0.51 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |