C10H21NO2 — CID 74554703
N-(1-hydroxy-3-methylbutan-2-yl)-3-methylbutanamide (PubChem CID 74554703) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylbutan-2-yl)-3-methylbutanamide.
| Compound Name | N-(1-hydroxy-3-methylbutan-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 74554703 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | N-(1-hydroxy-3-methylbutan-2-yl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NC(CO)C(C)C |
| InChI | InChI=1S/C10H21NO2/c1-7(2)5-10(13)11-9(6-12)8(3)4/h7-9,12H,5-6H2,1-4H3,(H,11,13) |
| InChIKey | NLZIGPBLTOEIQY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |