C12H23NO2 — CID 136588740
N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-4-methyl-2-methylidenepentanamide (PubChem CID 136588740) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-4-methyl-2-methylidenepentanamide.
| Compound Name | N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-4-methyl-2-methylidenepentanamide |
|---|---|
| PubChem CID | 136588740 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-4-methyl-2-methylidenepentanamide |
| SMILES | C=C(CC(C)C)C(=O)N[C@H](CO)C(C)C |
| InChI | InChI=1S/C12H23NO2/c1-8(2)6-10(5)12(15)13-11(7-14)9(3)4/h8-9,11,14H,5-7H2,1-4H3,(H,13,15)/t11-/m1/s1 |
| InChIKey | ZFDMNFXXXLQRAZ-LLVKDONJSA-N |
| XLogP | 1.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|