C10H20BrNO2 — CID 79248858
2-bromo-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-methylbutanamide (PubChem CID 79248858) has the molecular formula C10H20BrNO2 and a molecular weight of 266.18 g/mol. Its IUPAC name is 2-bromo-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-methylbutanamide.
| Compound Name | 2-bromo-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-methylbutanamide |
|---|---|
| PubChem CID | 79248858 |
| Molecular Formula | C10H20BrNO2 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 2-bromo-N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-3-methylbutanamide |
| SMILES | CC(C)C(Br)C(=O)N[C@H](CO)C(C)C |
| InChI | InChI=1S/C10H20BrNO2/c1-6(2)8(5-13)12-10(14)9(11)7(3)4/h6-9,13H,5H2,1-4H3,(H,12,14)/t8-,9?/m1/s1 |
| InChIKey | LUXNZCBYLIYXLC-VEDVMXKPSA-N |
| XLogP | 1.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|