C10H20ClNO2 — CID 79249535
3-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-2,2-dimethylpropanamide (PubChem CID 79249535) has the molecular formula C10H20ClNO2 and a molecular weight of 221.73 g/mol. Its IUPAC name is 3-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-2,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 79249535 |
| Molecular Formula | C10H20ClNO2 |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-chloro-N-(1-hydroxy-3-methylbutan-2-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)C(CO)NC(=O)C(C)(C)CCl |
| InChI | InChI=1S/C10H20ClNO2/c1-7(2)8(5-13)12-9(14)10(3,4)6-11/h7-8,13H,5-6H2,1-4H3,(H,12,14) |
| InChIKey | NBXJRNNARUAEFQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|