C12H24ClNO — CID 83141302
3-chloro-2,2-dimethyl-N-(2,3,3-trimethylbutyl)propanamide (PubChem CID 83141302) has the molecular formula C12H24ClNO and a molecular weight of 233.78 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-(2,3,3-trimethylbutyl)propanamide.
| Compound Name | 3-chloro-2,2-dimethyl-N-(2,3,3-trimethylbutyl)propanamide |
|---|---|
| PubChem CID | 83141302 |
| Molecular Formula | C12H24ClNO |
| Molecular Weight | 233.78 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-(2,3,3-trimethylbutyl)propanamide |
| SMILES | CC(CNC(=O)C(C)(C)CCl)C(C)(C)C |
| InChI | InChI=1S/C12H24ClNO/c1-9(11(2,3)4)7-14-10(15)12(5,6)8-13/h9H,7-8H2,1-6H3,(H,14,15) |
| InChIKey | LQBZWCHQCHFTRZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|