C14H30N2O — CID 83142759
3-amino-2,2,3-trimethyl-N-(2,3,3-trimethylbutyl)butanamide (PubChem CID 83142759) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 3-amino-2,2,3-trimethyl-N-(2,3,3-trimethylbutyl)butanamide.
| Compound Name | 3-amino-2,2,3-trimethyl-N-(2,3,3-trimethylbutyl)butanamide |
|---|---|
| PubChem CID | 83142759 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 3-amino-2,2,3-trimethyl-N-(2,3,3-trimethylbutyl)butanamide |
| SMILES | CC(CNC(=O)C(C)(C)C(C)(C)N)C(C)(C)C |
| InChI | InChI=1S/C14H30N2O/c1-10(12(2,3)4)9-16-11(17)13(5,6)14(7,8)15/h10H,9,15H2,1-8H3,(H,16,17) |
| InChIKey | QIYXHWBEPWSYEW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |