C10H22N2O3 — CID 66170383
3-amino-N-(2,3-dihydroxypropyl)-2,2,3-trimethylbutanamide (PubChem CID 66170383) has the molecular formula C10H22N2O3 and a molecular weight of 218.30 g/mol. Its IUPAC name is 3-amino-N-(2,3-dihydroxypropyl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-(2,3-dihydroxypropyl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 66170383 |
| Molecular Formula | C10H22N2O3 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.16 |
| IUPAC Name | 3-amino-N-(2,3-dihydroxypropyl)-2,2,3-trimethylbutanamide |
| SMILES | CC(C)(N)C(C)(C)C(=O)NCC(O)CO |
| InChI | InChI=1S/C10H22N2O3/c1-9(2,10(3,4)11)8(15)12-5-7(14)6-13/h7,13-14H,5-6,11H2,1-4H3,(H,12,15) |
| InChIKey | WOQRLWAOSRXMFE-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |