C11H25NO3 — CID 142322932
N-(2,3-dihydroxypropyl)-3,3-dimethylbutanamide;ethane (PubChem CID 142322932) has the molecular formula C11H25NO3 and a molecular weight of 219.32 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-3,3-dimethylbutanamide;ethane.
| Compound Name | N-(2,3-dihydroxypropyl)-3,3-dimethylbutanamide;ethane |
|---|---|
| PubChem CID | 142322932 |
| Molecular Formula | C11H25NO3 |
| Molecular Weight | 219.32 g/mol |
| Exact Mass | 219.18 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-3,3-dimethylbutanamide;ethane |
| SMILES | CC.CC(C)(C)CC(=O)NCC(O)CO |
| InChI | InChI=1S/C9H19NO3.C2H6/c1-9(2,3)4-8(13)10-5-7(12)6-11;1-2/h7,11-12H,4-6H2,1-3H3,(H,10,13);1-2H3 |
| InChIKey | UCMKAWYEONQLHR-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |