C8H17NO4 — CID 107939672
N-(2,3-dihydroxypropyl)-2-propoxyacetamide (PubChem CID 107939672) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-2-propoxyacetamide.
| Compound Name | N-(2,3-dihydroxypropyl)-2-propoxyacetamide |
|---|---|
| PubChem CID | 107939672 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-2-propoxyacetamide |
| SMILES | CCCOCC(=O)NCC(O)CO |
| InChI | InChI=1S/C8H17NO4/c1-2-3-13-6-8(12)9-4-7(11)5-10/h7,10-11H,2-6H2,1H3,(H,9,12) |
| InChIKey | RWDQCGAPLMGXCX-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|