C7H15NO3 — CID 20700885
N-(2,3-dihydroxypropyl)butanamide (PubChem CID 20700885) has the molecular formula C7H15NO3 and a molecular weight of 161.20 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)butanamide.
| Compound Name | N-(2,3-dihydroxypropyl)butanamide |
|---|---|
| PubChem CID | 20700885 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | N-(2,3-dihydroxypropyl)butanamide |
| SMILES | CCCC(=O)NCC(O)CO |
| InChI | InChI=1S/C7H15NO3/c1-2-3-7(11)8-4-6(10)5-9/h6,9-10H,2-5H2,1H3,(H,8,11) |
| InChIKey | LAVYZMYQWIRTEA-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |